![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 24-G-ZA-STG-000 - Identity of BEST.rtf | 26-Oct-2008 22:38 | 41K | |
| BKT Lowlands Meeting Material.zip | 26-Oct-2008 22:39 | 920K | |
| BKT_Beograd.ppt | 26-Oct-2008 22:43 | 3.2M | |
| BKT_Zagreb.ppt | 26-Oct-2008 23:09 | 23M | |
| BKT_Zagreb_novo.ppt | 26-Oct-2008 23:20 | 23M | |
| BKT_history_part.ppt | 26-Oct-2008 22:46 | 1.9M | |
| Circle of events.pdf | 26-Oct-2008 23:20 | 1.4M | |
| Structure of BEST.pdf | 26-Oct-2008 23:21 | 829K | |
| funpresentationofBEST.ppt | 26-Oct-2008 23:21 | 1.9M | |
| iBKT tasks - x4.pdf | 26-Oct-2008 23:21 | 21K | |
| structur [COLOR].pdf | 26-Oct-2008 23:21 | 35K | |